C20H18N2O6 — CID 2016330
(3-acetyl-4-oxidoquinoxalin-4-ium-2-yl)methyl 3,4-dimethoxybenzoate (PubChem CID 2016330) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is (3-acetyl-4-oxidoquinoxalin-4-ium-2-yl)methyl 3,4-dimethoxybenzoate.
| Compound Name | (3-acetyl-4-oxidoquinoxalin-4-ium-2-yl)methyl 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 2016330 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (3-acetyl-4-oxidoquinoxalin-4-ium-2-yl)methyl 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2nc3ccccc3[n+]([O-])c2C(C)=O)cc1OC |
| InChI | InChI=1S/C20H18N2O6/c1-12(23)19-15(21-14-6-4-5-7-16(14)22(19)25)11-28-20(24)13-8-9-17(26-2)18(10-13)27-3/h4-10H,11H2,1-3H3 |
| InChIKey | ZRJCJCKWVRPHSM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|