C21H18Cl2N2O8 — CID 3334828
methyl 6,7-dichloro-1-oxido-3-[(3,4,5-trimethoxybenzoyl)oxymethyl]quinoxalin-1-ium-2-carboxylate (PubChem CID 3334828) has the molecular formula C21H18Cl2N2O8 and a molecular weight of 497.29 g/mol. Its IUPAC name is methyl 6,7-dichloro-1-oxido-3-[(3,4,5-trimethoxybenzoyl)oxymethyl]quinoxalin-1-ium-2-carboxylate.
| Compound Name | methyl 6,7-dichloro-1-oxido-3-[(3,4,5-trimethoxybenzoyl)oxymethyl]quinoxalin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 3334828 |
| Molecular Formula | C21H18Cl2N2O8 |
| Molecular Weight | 497.29 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | methyl 6,7-dichloro-1-oxido-3-[(3,4,5-trimethoxybenzoyl)oxymethyl]quinoxalin-1-ium-2-carboxylate |
| SMILES | COC(=O)c1c(COC(=O)c2cc(OC)c(OC)c(OC)c2)nc2cc(Cl)c(Cl)cc2[n+]1[O-] |
| InChI | InChI=1S/C21H18Cl2N2O8/c1-29-16-5-10(6-17(30-2)19(16)31-3)20(26)33-9-14-18(21(27)32-4)25(28)15-8-12(23)11(22)7-13(15)24-14/h5-8H,9H2,1-4H3 |
| InChIKey | SITMKWKQUCWXLW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 120.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|