C24H16Cl2N2O4 — CID 3606970
(3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 4-methylbenzoate (PubChem CID 3606970) has the molecular formula C24H16Cl2N2O4 and a molecular weight of 467.31 g/mol. Its IUPAC name is (3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 4-methylbenzoate.
| Compound Name | (3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 3606970 |
| Molecular Formula | C24H16Cl2N2O4 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | (3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2nc3cc(Cl)c(Cl)cc3[n+]([O-])c2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H16Cl2N2O4/c1-14-7-9-16(10-8-14)24(30)32-13-20-22(23(29)15-5-3-2-4-6-15)28(31)21-12-18(26)17(25)11-19(21)27-20/h2-12H,13H2,1H3 |
| InChIKey | REHFCMKJGGTWGC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 83.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|