C24H16Cl2N2O5 — CID 3433019
(3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 2-phenoxyacetate (PubChem CID 3433019) has the molecular formula C24H16Cl2N2O5 and a molecular weight of 483.31 g/mol. Its IUPAC name is (3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 2-phenoxyacetate.
| Compound Name | (3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 2-phenoxyacetate |
|---|---|
| PubChem CID | 3433019 |
| Molecular Formula | C24H16Cl2N2O5 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | (3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 2-phenoxyacetate |
| SMILES | O=C(COc1ccccc1)OCc1nc2cc(Cl)c(Cl)cc2[n+]([O-])c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H16Cl2N2O5/c25-17-11-19-21(12-18(17)26)28(31)23(24(30)15-7-3-1-4-8-15)20(27-19)13-33-22(29)14-32-16-9-5-2-6-10-16/h1-12H,13-14H2 |
| InChIKey | LTGHRMIKDAMEKF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|