C22H22N2O5 — CID 3801874
(3-benzoyl-6-ethoxy-4-oxidoquinoxalin-4-ium-2-yl)methyl butanoate (PubChem CID 3801874) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is (3-benzoyl-6-ethoxy-4-oxidoquinoxalin-4-ium-2-yl)methyl butanoate.
| Compound Name | (3-benzoyl-6-ethoxy-4-oxidoquinoxalin-4-ium-2-yl)methyl butanoate |
|---|---|
| PubChem CID | 3801874 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (3-benzoyl-6-ethoxy-4-oxidoquinoxalin-4-ium-2-yl)methyl butanoate |
| SMILES | CCCC(=O)OCc1nc2ccc(OCC)cc2[n+]([O-])c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O5/c1-3-8-20(25)29-14-18-21(22(26)15-9-6-5-7-10-15)24(27)19-13-16(28-4-2)11-12-17(19)23-18/h5-7,9-13H,3-4,8,14H2,1-2H3 |
| InChIKey | ARFRHJUAMQIVLE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|