C20H18N2O5 — CID 3605758
(3-benzoyl-6-methoxy-4-oxidoquinoxalin-4-ium-2-yl)methyl propanoate (PubChem CID 3605758) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is (3-benzoyl-6-methoxy-4-oxidoquinoxalin-4-ium-2-yl)methyl propanoate.
| Compound Name | (3-benzoyl-6-methoxy-4-oxidoquinoxalin-4-ium-2-yl)methyl propanoate |
|---|---|
| PubChem CID | 3605758 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (3-benzoyl-6-methoxy-4-oxidoquinoxalin-4-ium-2-yl)methyl propanoate |
| SMILES | CCC(=O)OCc1nc2ccc(OC)cc2[n+]([O-])c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O5/c1-3-18(23)27-12-16-19(20(24)13-7-5-4-6-8-13)22(25)17-11-14(26-2)9-10-15(17)21-16/h4-11H,3,12H2,1-2H3 |
| InChIKey | QLWBNPUQODUTBS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|