C19H14Cl2N2O5 — CID 5096604
(3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 2-methoxyacetate (PubChem CID 5096604) has the molecular formula C19H14Cl2N2O5 and a molecular weight of 421.24 g/mol. Its IUPAC name is (3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 2-methoxyacetate.
| Compound Name | (3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 2-methoxyacetate |
|---|---|
| PubChem CID | 5096604 |
| Molecular Formula | C19H14Cl2N2O5 |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | (3-benzoyl-6,7-dichloro-4-oxidoquinoxalin-4-ium-2-yl)methyl 2-methoxyacetate |
| SMILES | COCC(=O)OCc1nc2cc(Cl)c(Cl)cc2[n+]([O-])c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H14Cl2N2O5/c1-27-10-17(24)28-9-15-18(19(25)11-5-3-2-4-6-11)23(26)16-8-13(21)12(20)7-14(16)22-15/h2-8H,9-10H2,1H3 |
| InChIKey | NEBXYWGOMZFTIZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|