About phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate
phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate (PubChem CID 8834290) has the molecular formula C23H17NO4
and a molecular weight of 371.39 g/mol. Its IUPAC name is phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate.
Molecular Properties
| Compound Name | phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate |
| PubChem CID | 8834290 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate |
| SMILES | O=Cc1ccc(OCC(=O)OCc2nc3ccccc3c3ccccc23)cc1 |
| InChI | InChI=1S/C23H17NO4/c25-13-16-9-11-17(12-10-16)27-15-23(26)28-14-22-20-7-2-1-5-18(20)19-6-3-4-8-21(19)24-22/h1-13H,14-15H2 |
| InChIKey | WWWVMOXNKVVIIW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate?
The IUPAC name of phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate (CID 8834290) is phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate.
What is the SMILES notation for phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate?
The canonical SMILES for phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate is O=Cc1ccc(OCC(=O)OCc2nc3ccccc3c3ccccc23)cc1.
What is the InChIKey of phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate?
The InChIKey is WWWVMOXNKVVIIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO4/c25-13-16-9-11-17(12-10-16)27-15-23(26)28-14-22-20-7-2-1-5-18(20)19-6-3-4-8-21(19)24-22/h1-13H,14-15H2.
What are the key properties of phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate?
phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate has a molecular weight of 371.39 g/mol, XLogP of 4.32, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthridin-6-ylmethyl 2-(4-formylphenoxy)acetate is sourced from PubChem (CID 8834290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).