C23H19N3O4 — CID 135734764
(4-oxo-3H-quinazolin-2-yl)methyl 2-(4-anilinophenoxy)acetate (PubChem CID 135734764) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is (4-oxo-3H-quinazolin-2-yl)methyl 2-(4-anilinophenoxy)acetate.
| Compound Name | (4-oxo-3H-quinazolin-2-yl)methyl 2-(4-anilinophenoxy)acetate |
|---|---|
| PubChem CID | 135734764 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (4-oxo-3H-quinazolin-2-yl)methyl 2-(4-anilinophenoxy)acetate |
| SMILES | O=C(COc1ccc(Nc2ccccc2)cc1)OCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C23H19N3O4/c27-22(30-14-21-25-20-9-5-4-8-19(20)23(28)26-21)15-29-18-12-10-17(11-13-18)24-16-6-2-1-3-7-16/h1-13,24H,14-15H2,(H,25,26,28) |
| InChIKey | BPQJTSNQXFIFJH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |