C23H42NO5Si+ — CID 3069374
dimethyl-(3-triethylsilylpropyl)-[2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium (PubChem CID 3069374) has the molecular formula C23H42NO5Si+ and a molecular weight of 440.68 g/mol. Its IUPAC name is dimethyl-(3-triethylsilylpropyl)-[2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium.
| Compound Name | dimethyl-(3-triethylsilylpropyl)-[2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium |
|---|---|
| PubChem CID | 3069374 |
| Molecular Formula | C23H42NO5Si+ |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | dimethyl-(3-triethylsilylpropyl)-[2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium |
| SMILES | CC[Si](CC)(CC)CCC[N+](C)(C)CCOC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H42NO5Si/c1-9-30(10-2,11-3)16-12-13-24(4,5)14-15-29-23(25)19-17-20(26-6)22(28-8)21(18-19)27-7/h17-18H,9-16H2,1-8H3/q+1 |
| InChIKey | SIVQZQZWUCYGEF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|