C17H28N2O5 — CID 170609272
3-(3-aminopropylamino)propyl 3-ethoxy-4,5-dimethoxybenzoate (PubChem CID 170609272) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-(3-aminopropylamino)propyl 3-ethoxy-4,5-dimethoxybenzoate.
| Compound Name | 3-(3-aminopropylamino)propyl 3-ethoxy-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 170609272 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-(3-aminopropylamino)propyl 3-ethoxy-4,5-dimethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCCCNCCCN)cc(OC)c1OC |
| InChI | InChI=1S/C17H28N2O5/c1-4-23-15-12-13(11-14(21-2)16(15)22-3)17(20)24-10-6-9-19-8-5-7-18/h11-12,19H,4-10,18H2,1-3H3 |
| InChIKey | VRKYRTVCWLIWSR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|