C16H20ClN4O2+ — CID 2016763
3-[[2-[(3-chlorophenoxy)methyl]-4-cyano-1,3-oxazol-5-yl]amino]propyl-dimethylazanium (PubChem CID 2016763) has the molecular formula C16H20ClN4O2+ and a molecular weight of 335.82 g/mol. Its IUPAC name is 3-[[2-[(3-chlorophenoxy)methyl]-4-cyano-1,3-oxazol-5-yl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[2-[(3-chlorophenoxy)methyl]-4-cyano-1,3-oxazol-5-yl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 2016763 |
| Molecular Formula | C16H20ClN4O2+ |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 3-[[2-[(3-chlorophenoxy)methyl]-4-cyano-1,3-oxazol-5-yl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNc1oc(COc2cccc(Cl)c2)nc1C#N |
| InChI | InChI=1S/C16H19ClN4O2/c1-21(2)8-4-7-19-16-14(10-18)20-15(23-16)11-22-13-6-3-5-12(17)9-13/h3,5-6,9,19H,4,7-8,11H2,1-2H3/p+1 |
| InChIKey | ZIASWKFZVGUFRU-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|