C24H26N4O3 — CID 664721
5-(3-morpholin-4-ylpropylamino)-2-[(4-phenylphenoxy)methyl]-1,3-oxazole-4-carbonitrile (PubChem CID 664721) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-(3-morpholin-4-ylpropylamino)-2-[(4-phenylphenoxy)methyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-(3-morpholin-4-ylpropylamino)-2-[(4-phenylphenoxy)methyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 664721 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 5-(3-morpholin-4-ylpropylamino)-2-[(4-phenylphenoxy)methyl]-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(COc2ccc(-c3ccccc3)cc2)oc1NCCCN1CCOCC1 |
| InChI | InChI=1S/C24H26N4O3/c25-17-22-24(26-11-4-12-28-13-15-29-16-14-28)31-23(27-22)18-30-21-9-7-20(8-10-21)19-5-2-1-3-6-19/h1-3,5-10,26H,4,11-16,18H2 |
| InChIKey | VNFUBVNOOAIKTF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|