C23H26N4O4 — CID 16958062
2-[5-[(4-methylphenoxy)methyl]furan-2-yl]-5-(3-morpholin-4-ylpropylamino)-1,3-oxazole-4-carbonitrile (PubChem CID 16958062) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[5-[(4-methylphenoxy)methyl]furan-2-yl]-5-(3-morpholin-4-ylpropylamino)-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-[5-[(4-methylphenoxy)methyl]furan-2-yl]-5-(3-morpholin-4-ylpropylamino)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 16958062 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[5-[(4-methylphenoxy)methyl]furan-2-yl]-5-(3-morpholin-4-ylpropylamino)-1,3-oxazole-4-carbonitrile |
| SMILES | Cc1ccc(OCc2ccc(-c3nc(C#N)c(NCCCN4CCOCC4)o3)o2)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-17-3-5-18(6-4-17)29-16-19-7-8-21(30-19)23-26-20(15-24)22(31-23)25-9-2-10-27-11-13-28-14-12-27/h3-8,25H,2,9-14,16H2,1H3 |
| InChIKey | ISDFEYXSISKQEB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|