C19H19N3O4 — CID 23610827
5-(2-methoxyethylamino)-2-[5-[(3-methylphenoxy)methyl]furan-2-yl]-1,3-oxazole-4-carbonitrile (PubChem CID 23610827) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 5-(2-methoxyethylamino)-2-[5-[(3-methylphenoxy)methyl]furan-2-yl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-(2-methoxyethylamino)-2-[5-[(3-methylphenoxy)methyl]furan-2-yl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 23610827 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 5-(2-methoxyethylamino)-2-[5-[(3-methylphenoxy)methyl]furan-2-yl]-1,3-oxazole-4-carbonitrile |
| SMILES | COCCNc1oc(-c2ccc(COc3cccc(C)c3)o2)nc1C#N |
| InChI | InChI=1S/C19H19N3O4/c1-13-4-3-5-14(10-13)24-12-15-6-7-17(25-15)19-22-16(11-20)18(26-19)21-8-9-23-2/h3-7,10,21H,8-9,12H2,1-2H3 |
| InChIKey | OLFQHQMWABBZJM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|