C24H23N3S — CID 2023283
6-benzyl-2,5-dimethyl-3-phenyl-7-prop-2-enylsulfanylpyrazolo[1,5-a]pyrimidine (PubChem CID 2023283) has the molecular formula C24H23N3S and a molecular weight of 385.54 g/mol. Its IUPAC name is 6-benzyl-2,5-dimethyl-3-phenyl-7-prop-2-enylsulfanylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 6-benzyl-2,5-dimethyl-3-phenyl-7-prop-2-enylsulfanylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 2023283 |
| Molecular Formula | C24H23N3S |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 6-benzyl-2,5-dimethyl-3-phenyl-7-prop-2-enylsulfanylpyrazolo[1,5-a]pyrimidine |
| SMILES | C=CCSc1c(Cc2ccccc2)c(C)nc2c(-c3ccccc3)c(C)nn12 |
| InChI | InChI=1S/C24H23N3S/c1-4-15-28-24-21(16-19-11-7-5-8-12-19)17(2)25-23-22(18(3)26-27(23)24)20-13-9-6-10-14-20/h4-14H,1,15-16H2,2-3H3 |
| InChIKey | DONBYCIXZOXZKQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|