C27H32N4 — CID 4639358
6-benzyl-N-hexyl-2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 4639358) has the molecular formula C27H32N4 and a molecular weight of 412.58 g/mol. Its IUPAC name is 6-benzyl-N-hexyl-2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-benzyl-N-hexyl-2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 4639358 |
| Molecular Formula | C27H32N4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 6-benzyl-N-hexyl-2,5-dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCCCCNc1c(Cc2ccccc2)c(C)nc2c(-c3ccccc3)c(C)nn12 |
| InChI | InChI=1S/C27H32N4/c1-4-5-6-13-18-28-26-24(19-22-14-9-7-10-15-22)20(2)29-27-25(21(3)30-31(26)27)23-16-11-8-12-17-23/h7-12,14-17,28H,4-6,13,18-19H2,1-3H3 |
| InChIKey | MNHCYQPDDIEUKV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|