C22H30N4 — CID 3321782
5-tert-butyl-2-methyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 3321782) has the molecular formula C22H30N4 and a molecular weight of 350.51 g/mol. Its IUPAC name is 5-tert-butyl-2-methyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-tert-butyl-2-methyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 3321782 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 5-tert-butyl-2-methyl-N-pentyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCCCNc1cc(C(C)(C)C)nc2c(-c3ccccc3)c(C)nn12 |
| InChI | InChI=1S/C22H30N4/c1-6-7-11-14-23-19-15-18(22(3,4)5)24-21-20(16(2)25-26(19)21)17-12-9-8-10-13-17/h8-10,12-13,15,23H,6-7,11,14H2,1-5H3 |
| InChIKey | UQRBURSDKUGOIP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|