C18H33NO2 — CID 20233407
3-Tetradecan-2-ylpyrrolidine-2,5-dione (PubChem CID 20233407) has the molecular formula C18H33NO2 and a molecular weight of 295.50 g/mol. Its IUPAC name is 3-tetradecan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-Tetradecan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 20233407 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.50 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | 3-tetradecan-2-ylpyrrolidine-2,5-dione |
| SMILES | CCCCCCCCCCCCC(C)C1CC(=O)NC1=O |
| InChI | InChI=1S/C18H33NO2/c1-3-4-5-6-7-8-9-10-11-12-13-15(2)16-14-17(20)19-18(16)21/h15-16H,3-14H2,1-2H3,(H,19,20,21) |
| InChIKey | JIYWVURPKJRMAB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | 314 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|