C10H20N4 — CID 20245303
2-Cyano-1,1-bis(2-methylpropyl)guanidine (PubChem CID 20245303) has the molecular formula C10H20N4 and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-cyano-1,1-bis(2-methylpropyl)guanidine.
| Compound Name | 2-Cyano-1,1-bis(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 20245303 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 2-cyano-1,1-bis(2-methylpropyl)guanidine |
| SMILES | CC(C)CN(CC(C)C)C(=NC#N)N |
| InChI | InChI=1S/C10H20N4/c1-8(2)5-14(6-9(3)4)10(12)13-7-11/h8-9H,5-6H2,1-4H3,(H2,12,13) |
| InChIKey | MBDRAZUMZRPZGS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | 224 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|