C20H18ClN5O2S2 — CID 2026113
(6Z)-6-[[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-methylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 2026113) has the molecular formula C20H18ClN5O2S2 and a molecular weight of 459.98 g/mol. Its IUPAC name is (6Z)-6-[[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-methylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-methylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 2026113 |
| Molecular Formula | C20H18ClN5O2S2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | (6Z)-6-[[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-methylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cc(C)n(-c3cc(Cl)ccc3OC)c2C)/C(=O)N=C2SC(SC)=NN2/1 |
| InChI | InChI=1S/C20H18ClN5O2S2/c1-10-7-12(11(2)25(10)15-9-13(21)5-6-16(15)28-3)8-14-17(22)26-19(23-18(14)27)30-20(24-26)29-4/h5-9,22H,1-4H3/b14-8-,22-17- |
| InChIKey | CTANLXQUCSCROB-FFFRNBSJSA-N |
| XLogP | 4.70 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|