C19H15Cl2N5OS2 — CID 3729618
6-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-methylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3729618) has the molecular formula C19H15Cl2N5OS2 and a molecular weight of 464.40 g/mol. Its IUPAC name is 6-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-methylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-methylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3729618 |
| Molecular Formula | C19H15Cl2N5OS2 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | 6-[[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-methylsulfanyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cc(C)n(-c3cc(Cl)cc(Cl)c3)c2C)C(=O)N=C2SC(SC)=NN21 |
| InChI | InChI=1S/C19H15Cl2N5OS2/c1-9-4-11(10(2)25(9)14-7-12(20)6-13(21)8-14)5-15-16(22)26-18(23-17(15)27)29-19(24-26)28-3/h4-8,22H,1-3H3/b15-5?,22-16- |
| InChIKey | QSPDQQGKFJAHQB-WRWMKHAVSA-N |
| XLogP | 5.34 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|