C13H15N4O3S+ — CID 2026214
[amino-[(6S)-6-[(4-methoxyphenyl)carbamoyl]-4-oxo-5,6-dihydro-1,3-thiazin-2-yl]methylidene]azanium (PubChem CID 2026214) has the molecular formula C13H15N4O3S+ and a molecular weight of 307.36 g/mol. Its IUPAC name is [amino-[(6S)-6-[(4-methoxyphenyl)carbamoyl]-4-oxo-5,6-dihydro-1,3-thiazin-2-yl]methylidene]azanium.
| Compound Name | [amino-[(6S)-6-[(4-methoxyphenyl)carbamoyl]-4-oxo-5,6-dihydro-1,3-thiazin-2-yl]methylidene]azanium |
|---|---|
| PubChem CID | 2026214 |
| Molecular Formula | C13H15N4O3S+ |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | [amino-[(6S)-6-[(4-methoxyphenyl)carbamoyl]-4-oxo-5,6-dihydro-1,3-thiazin-2-yl]methylidene]azanium |
| SMILES | COc1ccc(NC(=O)[C@@H]2CC(=O)N=C(C(N)=[NH2+])S2)cc1 |
| InChI | InChI=1S/C13H14N4O3S/c1-20-8-4-2-7(3-5-8)16-12(19)9-6-10(18)17-13(21-9)11(14)15/h2-5,9H,6H2,1H3,(H3,14,15)(H,16,19)/p+1/t9-/m0/s1 |
| InChIKey | OHEBOFRZADEKBQ-VIFPVBQESA-O |
| XLogP | -0.82 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|