About 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide
3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 2029178) has the molecular formula C20H21N3O2
and a molecular weight of 335.41 g/mol. Its IUPAC name is 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide |
| PubChem CID | 2029178 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cc(-c3ccc(C)c(C)c3O)n[nH]2)cc1 |
| InChI | InChI=1S/C20H21N3O2/c1-12-4-7-15(8-5-12)11-21-20(25)18-10-17(22-23-18)16-9-6-13(2)14(3)19(16)24/h4-10,24H,11H2,1-3H3,(H,21,25)(H,22,23) |
| InChIKey | OHZWUKQDMUGHGC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide?
The IUPAC name of 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide (CID 2029178) is 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide.
What is the SMILES notation for 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide?
The canonical SMILES for 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide is Cc1ccc(CNC(=O)c2cc(-c3ccc(C)c(C)c3O)n[nH]2)cc1.
What is the InChIKey of 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide?
The InChIKey is OHZWUKQDMUGHGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O2/c1-12-4-7-15(8-5-12)11-21-20(25)18-10-17(22-23-18)16-9-6-13(2)14(3)19(16)24/h4-10,24H,11H2,1-3H3,(H,21,25)(H,22,23).
What are the key properties of 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide?
3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide has a molecular weight of 335.41 g/mol, XLogP of 3.64, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxy-3,4-dimethylphenyl)-N-[(4-methylphenyl)methyl]-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 2029178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).