C26H25ClN4O4 — CID 2030267
ethyl 6-(4-chlorobenzoyl)imino-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 2030267) has the molecular formula C26H25ClN4O4 and a molecular weight of 492.96 g/mol. Its IUPAC name is ethyl 6-(4-chlorobenzoyl)imino-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 6-(4-chlorobenzoyl)imino-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 2030267 |
| Molecular Formula | C26H25ClN4O4 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | ethyl 6-(4-chlorobenzoyl)imino-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCCCCn1/c(=N/C(=O)c2ccc(Cl)cc2)c(C(=O)OCC)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C26H25ClN4O4/c1-3-5-7-15-31-22-19(25(33)30-14-8-6-9-21(30)28-22)16-20(26(34)35-4-2)23(31)29-24(32)17-10-12-18(27)13-11-17/h6,8-14,16H,3-5,7,15H2,1-2H3/b29-23+ |
| InChIKey | SRFLYBHGNCKTDT-BYNJWEBRSA-N |
| XLogP | 4.41 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|