C27H26Cl2N4O5 — CID 98424756
ethyl 7-butyl-6-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 98424756) has the molecular formula C27H26Cl2N4O5 and a molecular weight of 557.43 g/mol. Its IUPAC name is ethyl 7-butyl-6-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 7-butyl-6-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 98424756 |
| Molecular Formula | C27H26Cl2N4O5 |
| Molecular Weight | 557.43 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | ethyl 7-butyl-6-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]imino-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCCCn1/c(=N\C(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)c(C(=O)OCC)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C27H26Cl2N4O5/c1-4-6-12-33-23-18(26(35)32-13-8-7-9-22(32)30-23)15-19(27(36)37-5-2)24(33)31-25(34)16(3)38-21-11-10-17(28)14-20(21)29/h7-11,13-16H,4-6,12H2,1-3H3/b31-24-/t16-/m0/s1 |
| InChIKey | OEJISVHNLNPQNE-YRFMIVNWSA-N |
| XLogP | 4.83 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|