C26H24Cl2N4O5 — CID 98463448
ethyl 6-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]imino-2-oxo-7-propan-2-yl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 98463448) has the molecular formula C26H24Cl2N4O5 and a molecular weight of 543.41 g/mol. Its IUPAC name is ethyl 6-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]imino-2-oxo-7-propan-2-yl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 6-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]imino-2-oxo-7-propan-2-yl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 98463448 |
| Molecular Formula | C26H24Cl2N4O5 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | ethyl 6-[(2R)-2-(2,4-dichlorophenoxy)propanoyl]imino-2-oxo-7-propan-2-yl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C(C)C)/c1=N\C(=O)[C@@H](C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H24Cl2N4O5/c1-5-36-26(35)18-13-17-22(29-21-8-6-7-11-31(21)25(17)34)32(14(2)3)23(18)30-24(33)15(4)37-20-10-9-16(27)12-19(20)28/h6-15H,5H2,1-4H3/b30-23-/t15-/m1/s1 |
| InChIKey | FOTLPWMNGJBTTG-RADFDNFISA-N |
| XLogP | 4.61 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|