C28H30N4O4 — CID 2152361
ethyl 7-(2-methylpropyl)-2-oxo-6-[(2S)-2-phenylbutanoyl]imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 2152361) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is ethyl 7-(2-methylpropyl)-2-oxo-6-[(2S)-2-phenylbutanoyl]imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 7-(2-methylpropyl)-2-oxo-6-[(2S)-2-phenylbutanoyl]imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 2152361 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | ethyl 7-(2-methylpropyl)-2-oxo-6-[(2S)-2-phenylbutanoyl]imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(CC(C)C)/c1=N/C(=O)[C@@H](CC)c1ccccc1 |
| InChI | InChI=1S/C28H30N4O4/c1-5-20(19-12-8-7-9-13-19)26(33)30-25-22(28(35)36-6-2)16-21-24(32(25)17-18(3)4)29-23-14-10-11-15-31(23)27(21)34/h7-16,18,20H,5-6,17H2,1-4H3/b30-25+/t20-/m0/s1 |
| InChIKey | ITSLDBAKRGZWAU-FHRUIIQFSA-N |
| XLogP | 4.10 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|