C29H26N4O5 — CID 23826493
ethyl 7-(furan-2-ylmethyl)-2-oxo-6-(2-phenylbutanoylimino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 23826493) has the molecular formula C29H26N4O5 and a molecular weight of 510.55 g/mol. Its IUPAC name is ethyl 7-(furan-2-ylmethyl)-2-oxo-6-(2-phenylbutanoylimino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 7-(furan-2-ylmethyl)-2-oxo-6-(2-phenylbutanoylimino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 23826493 |
| Molecular Formula | C29H26N4O5 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | ethyl 7-(furan-2-ylmethyl)-2-oxo-6-(2-phenylbutanoylimino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(Cc2ccco2)/c1=N/C(=O)C(CC)c1ccccc1 |
| InChI | InChI=1S/C29H26N4O5/c1-3-21(19-11-6-5-7-12-19)27(34)31-26-23(29(36)37-4-2)17-22-25(33(26)18-20-13-10-16-38-20)30-24-14-8-9-15-32(24)28(22)35/h5-17,21H,3-4,18H2,1-2H3/b31-26+ |
| InChIKey | VNGULFUCAQKEHN-GKPLWNPISA-N |
| XLogP | 4.09 |
| TPSA | 108.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|