C29H22N4O6 — CID 5056263
ethyl 6-(1,3-benzodioxole-5-carbonylimino)-7-benzyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 5056263) has the molecular formula C29H22N4O6 and a molecular weight of 522.52 g/mol. Its IUPAC name is ethyl 6-(1,3-benzodioxole-5-carbonylimino)-7-benzyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 6-(1,3-benzodioxole-5-carbonylimino)-7-benzyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 5056263 |
| Molecular Formula | C29H22N4O6 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | ethyl 6-(1,3-benzodioxole-5-carbonylimino)-7-benzyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(Cc2ccccc2)/c1=N/C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H22N4O6/c1-2-37-29(36)21-15-20-25(30-24-10-6-7-13-32(24)28(20)35)33(16-18-8-4-3-5-9-18)26(21)31-27(34)19-11-12-22-23(14-19)39-17-38-22/h3-15H,2,16-17H2,1H3/b31-26+ |
| InChIKey | ZIGSUFZLJCGBFZ-GKPLWNPISA-N |
| XLogP | 3.34 |
| TPSA | 113.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|