C28H26N4O7 — CID 2016247
ethyl 6-(1,3-benzodioxole-5-carbonylimino)-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 2016247) has the molecular formula C28H26N4O7 and a molecular weight of 530.54 g/mol. Its IUPAC name is ethyl 6-(1,3-benzodioxole-5-carbonylimino)-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 6-(1,3-benzodioxole-5-carbonylimino)-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 2016247 |
| Molecular Formula | C28H26N4O7 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | ethyl 6-(1,3-benzodioxole-5-carbonylimino)-11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3cccc(C)c3nc2n(C[C@H]2CCCO2)/c1=N/C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H26N4O7/c1-3-36-28(35)20-13-19-24(29-23-16(2)6-4-10-31(23)27(19)34)32(14-18-7-5-11-37-18)25(20)30-26(33)17-8-9-21-22(12-17)39-15-38-21/h4,6,8-10,12-13,18H,3,5,7,11,14-15H2,1-2H3/b30-25+/t18-/m1/s1 |
| InChIKey | DXSPKPCNYSHWTC-XZIFACHUSA-N |
| XLogP | 2.78 |
| TPSA | 122.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|