C26H25N5O5 — CID 2013049
ethyl 11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-6-(pyridine-3-carbonylimino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 2013049) has the molecular formula C26H25N5O5 and a molecular weight of 487.52 g/mol. Its IUPAC name is ethyl 11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-6-(pyridine-3-carbonylimino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-6-(pyridine-3-carbonylimino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 2013049 |
| Molecular Formula | C26H25N5O5 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | ethyl 11-methyl-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-6-(pyridine-3-carbonylimino)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3cccc(C)c3nc2n(C[C@H]2CCCO2)/c1=N/C(=O)c1cccnc1 |
| InChI | InChI=1S/C26H25N5O5/c1-3-35-26(34)20-13-19-22(28-21-16(2)7-5-11-30(21)25(19)33)31(15-18-9-6-12-36-18)23(20)29-24(32)17-8-4-10-27-14-17/h4-5,7-8,10-11,13-14,18H,3,6,9,12,15H2,1-2H3/b29-23+/t18-/m1/s1 |
| InChIKey | XXHCKWPISWHRPT-JYOQAOIBSA-N |
| XLogP | 2.45 |
| TPSA | 117.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|