C28H27N5O7 — CID 4977370
ethyl 11-methyl-6-(2-methyl-3-nitrobenzoyl)imino-2-oxo-7-(oxolan-2-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 4977370) has the molecular formula C28H27N5O7 and a molecular weight of 545.55 g/mol. Its IUPAC name is ethyl 11-methyl-6-(2-methyl-3-nitrobenzoyl)imino-2-oxo-7-(oxolan-2-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 11-methyl-6-(2-methyl-3-nitrobenzoyl)imino-2-oxo-7-(oxolan-2-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 4977370 |
| Molecular Formula | C28H27N5O7 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | ethyl 11-methyl-6-(2-methyl-3-nitrobenzoyl)imino-2-oxo-7-(oxolan-2-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3cccc(C)c3nc2n(CC2CCCO2)/c1=N/C(=O)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C28H27N5O7/c1-4-39-28(36)21-14-20-24(29-23-16(2)8-6-12-31(23)27(20)35)32(15-18-9-7-13-40-18)25(21)30-26(34)19-10-5-11-22(17(19)3)33(37)38/h5-6,8,10-12,14,18H,4,7,9,13,15H2,1-3H3/b30-25+ |
| InChIKey | ZSMRJUTZTSDWRE-QCWLDUFUSA-N |
| XLogP | 3.27 |
| TPSA | 147.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|