C26H22N6O5 — CID 3394608
N-[5-cyano-11-methyl-2-oxo-7-(oxolan-2-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-2-methyl-3-nitrobenzamide (PubChem CID 3394608) has the molecular formula C26H22N6O5 and a molecular weight of 498.50 g/mol. Its IUPAC name is N-[5-cyano-11-methyl-2-oxo-7-(oxolan-2-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[5-cyano-11-methyl-2-oxo-7-(oxolan-2-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 3394608 |
| Molecular Formula | C26H22N6O5 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-[5-cyano-11-methyl-2-oxo-7-(oxolan-2-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)/N=c2\c(C#N)cc3c(=O)n4cccc(C)c4nc3n2CC2CCCO2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H22N6O5/c1-15-6-4-10-30-22(15)28-24-20(26(30)34)12-17(13-27)23(31(24)14-18-7-5-11-37-18)29-25(33)19-8-3-9-21(16(19)2)32(35)36/h3-4,6,8-10,12,18H,5,7,11,14H2,1-2H3/b29-23+ |
| InChIKey | FUZPKOOFMJLOFS-BYNJWEBRSA-N |
| XLogP | 2.97 |
| TPSA | 144.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|