C28H28N4O5 — CID 2020357
ethyl 11-methyl-6-(4-methylbenzoyl)imino-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 2020357) has the molecular formula C28H28N4O5 and a molecular weight of 500.56 g/mol. Its IUPAC name is ethyl 11-methyl-6-(4-methylbenzoyl)imino-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 11-methyl-6-(4-methylbenzoyl)imino-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 2020357 |
| Molecular Formula | C28H28N4O5 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | ethyl 11-methyl-6-(4-methylbenzoyl)imino-2-oxo-7-[[(2R)-oxolan-2-yl]methyl]-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3cccc(C)c3nc2n(C[C@H]2CCCO2)/c1=N/C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H28N4O5/c1-4-36-28(35)22-15-21-24(29-23-18(3)7-5-13-31(23)27(21)34)32(16-20-8-6-14-37-20)25(22)30-26(33)19-11-9-17(2)10-12-19/h5,7,9-13,15,20H,4,6,8,14,16H2,1-3H3/b30-25+/t20-/m1/s1 |
| InChIKey | XWUXBMCFSFWDTP-BGPWEIADSA-N |
| XLogP | 3.36 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|