C27H26N4O7 — CID 3775948
ethyl 6-(1,3-benzodioxole-5-carbonylimino)-7-(3-ethoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 3775948) has the molecular formula C27H26N4O7 and a molecular weight of 518.53 g/mol. Its IUPAC name is ethyl 6-(1,3-benzodioxole-5-carbonylimino)-7-(3-ethoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 6-(1,3-benzodioxole-5-carbonylimino)-7-(3-ethoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 3775948 |
| Molecular Formula | C27H26N4O7 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | ethyl 6-(1,3-benzodioxole-5-carbonylimino)-7-(3-ethoxypropyl)-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOCCCn1/c(=N/C(=O)c2ccc3c(c2)OCO3)c(C(=O)OCC)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C27H26N4O7/c1-3-35-13-7-12-31-23-18(26(33)30-11-6-5-8-22(30)28-23)15-19(27(34)36-4-2)24(31)29-25(32)17-9-10-20-21(14-17)38-16-37-20/h5-6,8-11,14-15H,3-4,7,12-13,16H2,1-2H3/b29-24+ |
| InChIKey | WCUPVMQVMRJZHC-RMLRFSFXSA-N |
| XLogP | 2.72 |
| TPSA | 122.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|