C35H36N4O7 — CID 3665619
ethyl 2-oxo-7-(2-phenylethyl)-6-(3,4,5-triethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 3665619) has the molecular formula C35H36N4O7 and a molecular weight of 624.69 g/mol. Its IUPAC name is ethyl 2-oxo-7-(2-phenylethyl)-6-(3,4,5-triethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 2-oxo-7-(2-phenylethyl)-6-(3,4,5-triethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 3665619 |
| Molecular Formula | C35H36N4O7 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | ethyl 2-oxo-7-(2-phenylethyl)-6-(3,4,5-triethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(CCc2ccccc2)/c1=N/C(=O)c1cc(OCC)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C35H36N4O7/c1-5-43-27-20-24(21-28(44-6-2)30(27)45-7-3)33(40)37-32-26(35(42)46-8-4)22-25-31(36-29-16-12-13-18-38(29)34(25)41)39(32)19-17-23-14-10-9-11-15-23/h9-16,18,20-22H,5-8,17,19H2,1-4H3/b37-32+ |
| InChIKey | DBVDURLYQYVGOQ-BQNXFWFHSA-N |
| XLogP | 5.01 |
| TPSA | 122.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|