C26H20F6N4O4 — CID 2155908
ethyl 6-[3,5-bis(trifluoromethyl)benzoyl]imino-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 2155908) has the molecular formula C26H20F6N4O4 and a molecular weight of 566.46 g/mol. Its IUPAC name is ethyl 6-[3,5-bis(trifluoromethyl)benzoyl]imino-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 6-[3,5-bis(trifluoromethyl)benzoyl]imino-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 2155908 |
| Molecular Formula | C26H20F6N4O4 |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | ethyl 6-[3,5-bis(trifluoromethyl)benzoyl]imino-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCCn1/c(=N/C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(C(=O)OCC)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C26H20F6N4O4/c1-3-8-36-20-17(23(38)35-9-6-5-7-19(35)33-20)13-18(24(39)40-4-2)21(36)34-22(37)14-10-15(25(27,28)29)12-16(11-14)26(30,31)32/h5-7,9-13H,3-4,8H2,1-2H3/b34-21+ |
| InChIKey | MCFLHMNDQOLWAC-KEIPNQJHSA-N |
| XLogP | 5.01 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|