C29H21F3N4O4 — CID 3503941
ethyl 7-benzyl-2-oxo-6-[2-(trifluoromethyl)benzoyl]imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 3503941) has the molecular formula C29H21F3N4O4 and a molecular weight of 546.51 g/mol. Its IUPAC name is ethyl 7-benzyl-2-oxo-6-[2-(trifluoromethyl)benzoyl]imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 7-benzyl-2-oxo-6-[2-(trifluoromethyl)benzoyl]imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 3503941 |
| Molecular Formula | C29H21F3N4O4 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | ethyl 7-benzyl-2-oxo-6-[2-(trifluoromethyl)benzoyl]imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(Cc2ccccc2)/c1=N\C(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C29H21F3N4O4/c1-2-40-28(39)21-16-20-24(33-23-14-8-9-15-35(23)27(20)38)36(17-18-10-4-3-5-11-18)25(21)34-26(37)19-12-6-7-13-22(19)29(30,31)32/h3-16H,2,17H2,1H3/b34-25- |
| InChIKey | VWEMIVAKVLOKJH-NQUVTRGKSA-N |
| XLogP | 4.63 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|