C29H23N5O6 — CID 4055570
ethyl 6-(3-nitrobenzoyl)imino-2-oxo-7-(2-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 4055570) has the molecular formula C29H23N5O6 and a molecular weight of 537.53 g/mol. Its IUPAC name is ethyl 6-(3-nitrobenzoyl)imino-2-oxo-7-(2-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 6-(3-nitrobenzoyl)imino-2-oxo-7-(2-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 4055570 |
| Molecular Formula | C29H23N5O6 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | ethyl 6-(3-nitrobenzoyl)imino-2-oxo-7-(2-phenylethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(CCc2ccccc2)/c1=N/C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H23N5O6/c1-2-40-29(37)23-18-22-25(30-24-13-6-7-15-32(24)28(22)36)33(16-14-19-9-4-3-5-10-19)26(23)31-27(35)20-11-8-12-21(17-20)34(38)39/h3-13,15,17-18H,2,14,16H2,1H3/b31-26+ |
| InChIKey | XSCKVWPHEDOIIN-GKPLWNPISA-N |
| XLogP | 3.72 |
| TPSA | 138.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|