C33H34N4O8 — CID 4921058
ethyl 7-(furan-2-ylmethyl)-11-methyl-2-oxo-6-(3,4,5-triethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 4921058) has the molecular formula C33H34N4O8 and a molecular weight of 614.65 g/mol. Its IUPAC name is ethyl 7-(furan-2-ylmethyl)-11-methyl-2-oxo-6-(3,4,5-triethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 7-(furan-2-ylmethyl)-11-methyl-2-oxo-6-(3,4,5-triethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 4921058 |
| Molecular Formula | C33H34N4O8 |
| Molecular Weight | 614.65 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | ethyl 7-(furan-2-ylmethyl)-11-methyl-2-oxo-6-(3,4,5-triethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3cccc(C)c3nc2n(Cc2ccco2)/c1=N/C(=O)c1cc(OCC)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C33H34N4O8/c1-6-41-25-16-21(17-26(42-7-2)27(25)43-8-3)31(38)35-30-24(33(40)44-9-4)18-23-29(37(30)19-22-13-11-15-45-22)34-28-20(5)12-10-14-36(28)32(23)39/h10-18H,6-9,19H2,1-5H3/b35-30+ |
| InChIKey | LXHPGUOGLHZNTR-WUZYOQQESA-N |
| XLogP | 4.71 |
| TPSA | 135.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|