C30H28N4O8 — CID 2068949
ethyl 7-(furan-2-ylmethyl)-11-methyl-2-oxo-6-(3,4,5-trimethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 2068949) has the molecular formula C30H28N4O8 and a molecular weight of 572.57 g/mol. Its IUPAC name is ethyl 7-(furan-2-ylmethyl)-11-methyl-2-oxo-6-(3,4,5-trimethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 7-(furan-2-ylmethyl)-11-methyl-2-oxo-6-(3,4,5-trimethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 2068949 |
| Molecular Formula | C30H28N4O8 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | ethyl 7-(furan-2-ylmethyl)-11-methyl-2-oxo-6-(3,4,5-trimethoxybenzoyl)imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3cccc(C)c3nc2n(Cc2ccco2)/c1=N/C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C30H28N4O8/c1-6-41-30(37)21-15-20-26(31-25-17(2)9-7-11-33(25)29(20)36)34(16-19-10-8-12-42-19)27(21)32-28(35)18-13-22(38-3)24(40-5)23(14-18)39-4/h7-15H,6,16H2,1-5H3/b32-27+ |
| InChIKey | WIAMMFOXMIQPOE-QVAGMWBUSA-N |
| XLogP | 3.54 |
| TPSA | 135.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|