C21H19N3O4S — CID 2034514
(E)-3-(1,3-benzodioxol-5-yl)-N-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]carbamothioyl]prop-2-enamide (PubChem CID 2034514) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 2034514 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NC(=S)NNC(=O)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H19N3O4S/c25-19(9-7-13-6-8-17-18(10-13)28-12-27-17)22-21(29)24-23-20(26)16-11-15(16)14-4-2-1-3-5-14/h1-10,15-16H,11-12H2,(H,23,26)(H2,22,24,25,29)/b9-7+/t15-,16+/m0/s1 |
| InChIKey | SLOHMZWPCSKOFS-KBUFDJFCSA-N |
| XLogP | 2.25 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|