C19H17N3O4 — CID 6557039
trans-(1R,2R)-N'-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-2-phenylcyclopropane-1-carbohydrazide (PubChem CID 6557039) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is trans-(1R,2R)-N'-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-2-phenylcyclopropane-1-carbohydrazide.
| Compound Name | trans-(1R,2R)-N'-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-2-phenylcyclopropane-1-carbohydrazide |
|---|---|
| PubChem CID | 6557039 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | trans-(1R,2R)-N'-[(E)-3-(4-nitrophenyl)prop-2-enoyl]-2-phenylcyclopropane-1-carbohydrazide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NNC(=O)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H17N3O4/c23-18(11-8-13-6-9-15(10-7-13)22(25)26)20-21-19(24)17-12-16(17)14-4-2-1-3-5-14/h1-11,16-17H,12H2,(H,20,23)(H,21,24)/b11-8+/t16-,17+/m0/s1 |
| InChIKey | XQCBUEOBLUJVME-VESHTZQJSA-N |
| XLogP | 2.56 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|