C21H17N3O4 — CID 17187055
(E)-N'-(2-naphthalen-1-ylacetyl)-3-(4-nitrophenyl)prop-2-enehydrazide (PubChem CID 17187055) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is (E)-N'-(2-naphthalen-1-ylacetyl)-3-(4-nitrophenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-(2-naphthalen-1-ylacetyl)-3-(4-nitrophenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 17187055 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (E)-N'-(2-naphthalen-1-ylacetyl)-3-(4-nitrophenyl)prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H17N3O4/c25-20(13-10-15-8-11-18(12-9-15)24(27)28)22-23-21(26)14-17-6-3-5-16-4-1-2-7-19(16)17/h1-13H,14H2,(H,22,25)(H,23,26)/b13-10+ |
| InChIKey | ICVRFLPGZPWXNN-JLHYYAGUSA-N |
| XLogP | 3.15 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|