C14H14N2O4 — CID 7430948
4-oxo-4-[2-[(1S,2S)-2-phenylcyclopropanecarbonyl]hydrazinyl]but-2-enoic acid (PubChem CID 7430948) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-oxo-4-[2-[(1S,2S)-2-phenylcyclopropanecarbonyl]hydrazinyl]but-2-enoic acid.
| Compound Name | 4-oxo-4-[2-[(1S,2S)-2-phenylcyclopropanecarbonyl]hydrazinyl]but-2-enoic acid |
|---|---|
| PubChem CID | 7430948 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-oxo-4-[2-[(1S,2S)-2-phenylcyclopropanecarbonyl]hydrazinyl]but-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NNC(=O)[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H14N2O4/c17-12(6-7-13(18)19)15-16-14(20)11-8-10(11)9-4-2-1-3-5-9/h1-7,10-11H,8H2,(H,15,17)(H,16,20)(H,18,19)/t10-,11+/m1/s1 |
| InChIKey | LNTZNXCWGIGMBO-MNOVXSKESA-N |
| XLogP | 0.58 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|