C15H14N2O2S — CID 691734
N'-[(1R,2S)-2-phenylcyclopropanecarbonyl]thiophene-2-carbohydrazide (PubChem CID 691734) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is N'-[(1R,2S)-2-phenylcyclopropanecarbonyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[(1R,2S)-2-phenylcyclopropanecarbonyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 691734 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N'-[(1R,2S)-2-phenylcyclopropanecarbonyl]thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1C[C@@H]1c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C15H14N2O2S/c18-14(16-17-15(19)13-7-4-8-20-13)12-9-11(12)10-5-2-1-3-6-10/h1-8,11-12H,9H2,(H,16,18)(H,17,19)/t11-,12-/m1/s1 |
| InChIKey | NMUWNWFKRQPMAD-VXGBXAGGSA-N |
| XLogP | 2.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|