C13H16N2O4S — CID 6544086
trans-(1R,2R)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 6544086) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 6544086 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | trans-(1R,2R)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NNC(=O)[C@@H]1CCCC[C@H]1C(=O)O)c1cccs1 |
| InChI | InChI=1S/C13H16N2O4S/c16-11(8-4-1-2-5-9(8)13(18)19)14-15-12(17)10-6-3-7-20-10/h3,6-9H,1-2,4-5H2,(H,14,16)(H,15,17)(H,18,19)/t8-,9-/m1/s1 |
| InChIKey | DBRWFJAGJJIIRW-RKDXNWHRSA-N |
| XLogP | 1.40 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|