C13H17N3O4S — CID 43441254
1-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]piperidine-2-carboxylic acid (PubChem CID 43441254) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 1-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43441254 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]piperidine-2-carboxylic acid |
| SMILES | O=C(CN1CCCCC1C(=O)O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C13H17N3O4S/c17-11(14-15-12(18)10-5-3-7-21-10)8-16-6-2-1-4-9(16)13(19)20/h3,5,7,9H,1-2,4,6,8H2,(H,14,17)(H,15,18)(H,19,20) |
| InChIKey | GZJINSWVTCYHSK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|