C12H17N3O3S — CID 60674119
N'-[2-(4-hydroxypiperidin-1-yl)acetyl]thiophene-2-carbohydrazide (PubChem CID 60674119) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is N'-[2-(4-hydroxypiperidin-1-yl)acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(4-hydroxypiperidin-1-yl)acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 60674119 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N'-[2-(4-hydroxypiperidin-1-yl)acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CN1CCC(O)CC1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C12H17N3O3S/c16-9-3-5-15(6-4-9)8-11(17)13-14-12(18)10-2-1-7-19-10/h1-2,7,9,16H,3-6,8H2,(H,13,17)(H,14,18) |
| InChIKey | YEPNMMCXLWXMJJ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|